C23H40O2Si — CID 11303416
(E,8S)-17-[tert-butyl(dimethyl)silyl]oxyheptadec-9-en-11,13-diyn-8-ol (PubChem CID 11303416) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is (E,8S)-17-[tert-butyl(dimethyl)silyl]oxyheptadec-9-en-11,13-diyn-8-ol.
| Compound Name | (E,8S)-17-[tert-butyl(dimethyl)silyl]oxyheptadec-9-en-11,13-diyn-8-ol |
|---|---|
| PubChem CID | 11303416 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (E,8S)-17-[tert-butyl(dimethyl)silyl]oxyheptadec-9-en-11,13-diyn-8-ol |
| SMILES | CCCCCCC[C@H](O)/C=C/C#CC#CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O2Si/c1-7-8-9-13-16-19-22(24)20-17-14-11-10-12-15-18-21-25-26(5,6)23(2,3)4/h17,20,22,24H,7-9,13,15-16,18-19,21H2,1-6H3/b20-17+/t22-/m0/s1 |
| InChIKey | AXAIHXBHYOCJEU-YDPLAMGBSA-N |
| XLogP | 6.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|