C12H19Cl2N2O4PS — CID 11303814
N-[2-(benzenesulfonyl)ethoxy-(2-chloroethylamino)phosphoryl]-2-chloroethanamine (PubChem CID 11303814) has the molecular formula C12H19Cl2N2O4PS and a molecular weight of 389.24 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethoxy-(2-chloroethylamino)phosphoryl]-2-chloroethanamine.
| Compound Name | N-[2-(benzenesulfonyl)ethoxy-(2-chloroethylamino)phosphoryl]-2-chloroethanamine |
|---|---|
| PubChem CID | 11303814 |
| Molecular Formula | C12H19Cl2N2O4PS |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethoxy-(2-chloroethylamino)phosphoryl]-2-chloroethanamine |
| SMILES | O=P(NCCCl)(NCCCl)OCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19Cl2N2O4PS/c13-6-8-15-21(17,16-9-7-14)20-10-11-22(18,19)12-4-2-1-3-5-12/h1-5H,6-11H2,(H2,15,16,17) |
| InChIKey | ZVDRSXRIOQKZPJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|