C19H14N6O3S — CID 11304305
7-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethylimidazo[4,5-c]pyridin-6-yl]sulfanylchromen-2-one (PubChem CID 11304305) has the molecular formula C19H14N6O3S and a molecular weight of 406.43 g/mol. Its IUPAC name is 7-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethylimidazo[4,5-c]pyridin-6-yl]sulfanylchromen-2-one.
| Compound Name | 7-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethylimidazo[4,5-c]pyridin-6-yl]sulfanylchromen-2-one |
|---|---|
| PubChem CID | 11304305 |
| Molecular Formula | C19H14N6O3S |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 7-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethylimidazo[4,5-c]pyridin-6-yl]sulfanylchromen-2-one |
| SMILES | CCn1c(-c2nonc2N)nc2cnc(Sc3ccc4ccc(=O)oc4c3)cc21 |
| InChI | InChI=1S/C19H14N6O3S/c1-2-25-13-8-15(21-9-12(13)22-19(25)17-18(20)24-28-23-17)29-11-5-3-10-4-6-16(26)27-14(10)7-11/h3-9H,2H2,1H3,(H2,20,24) |
| InChIKey | NQCOUFBDJCOOJU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 125.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|