C18H17N5O — CID 113050407
N-[6-(quinolin-8-ylamino)pyridazin-3-yl]cyclobutanecarboxamide (PubChem CID 113050407) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is N-[6-(quinolin-8-ylamino)pyridazin-3-yl]cyclobutanecarboxamide.
| Compound Name | N-[6-(quinolin-8-ylamino)pyridazin-3-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 113050407 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[6-(quinolin-8-ylamino)pyridazin-3-yl]cyclobutanecarboxamide |
| SMILES | O=C(Nc1ccc(Nc2cccc3cccnc23)nn1)C1CCC1 |
| InChI | InChI=1S/C18H17N5O/c24-18(13-5-1-6-13)21-16-10-9-15(22-23-16)20-14-8-2-4-12-7-3-11-19-17(12)14/h2-4,7-11,13H,1,5-6H2,(H,20,22)(H,21,23,24) |
| InChIKey | RZNOHJVGSVDCNK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |