C15H26N2O5S2 — CID 113065559
4-ethoxy-N-[2-[2-methylpropyl(methylsulfonyl)amino]ethyl]benzenesulfonamide (PubChem CID 113065559) has the molecular formula C15H26N2O5S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[2-methylpropyl(methylsulfonyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[2-[2-methylpropyl(methylsulfonyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113065559 |
| Molecular Formula | C15H26N2O5S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 4-ethoxy-N-[2-[2-methylpropyl(methylsulfonyl)amino]ethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCN(CC(C)C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H26N2O5S2/c1-5-22-14-6-8-15(9-7-14)24(20,21)16-10-11-17(12-13(2)3)23(4,18)19/h6-9,13,16H,5,10-12H2,1-4H3 |
| InChIKey | XIENBXDAAXUEEY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |