C13H16O2 — CID 11310231
(1S,4S,8S)-4-methoxytricyclo[6.2.2.01,5]dodeca-5,9-dien-7-one (PubChem CID 11310231) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (1S,4S,8S)-4-methoxytricyclo[6.2.2.01,5]dodeca-5,9-dien-7-one.
| Compound Name | (1S,4S,8S)-4-methoxytricyclo[6.2.2.01,5]dodeca-5,9-dien-7-one |
|---|---|
| PubChem CID | 11310231 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (1S,4S,8S)-4-methoxytricyclo[6.2.2.01,5]dodeca-5,9-dien-7-one |
| SMILES | CO[C@H]1CC[C@]23C=C[C@H](CC2)C(=O)C=C13 |
| InChI | InChI=1S/C13H16O2/c1-15-12-4-7-13-5-2-9(3-6-13)11(14)8-10(12)13/h2,5,8-9,12H,3-4,6-7H2,1H3/t9-,12+,13+/m1/s1 |
| InChIKey | CWCYOUJDZULQHS-ICCXJUOJSA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|