C16H17NO3S — CID 11312727
(4S)-3,4-dibenzyloxathiazolidine 2,2-dioxide (PubChem CID 11312727) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is (4S)-3,4-dibenzyloxathiazolidine 2,2-dioxide.
| Compound Name | (4S)-3,4-dibenzyloxathiazolidine 2,2-dioxide |
|---|---|
| PubChem CID | 11312727 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (4S)-3,4-dibenzyloxathiazolidine 2,2-dioxide |
| SMILES | O=S1(=O)OC[C@H](Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO3S/c18-21(19)17(12-15-9-5-2-6-10-15)16(13-20-21)11-14-7-3-1-4-8-14/h1-10,16H,11-13H2/t16-/m0/s1 |
| InChIKey | QPRNLBKAYQRZFN-INIZCTEOSA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |