C22H16S — CID 11312986
2,3,5-triphenylthiophene (PubChem CID 11312986) has the molecular formula C22H16S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2,3,5-triphenylthiophene.
| Compound Name | 2,3,5-triphenylthiophene |
|---|---|
| PubChem CID | 11312986 |
| Molecular Formula | C22H16S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2,3,5-triphenylthiophene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C22H16S/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)23-22(20)19-14-8-3-9-15-19/h1-16H |
| InChIKey | QIQRZPZOOFRYRL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |