C18H22O3Si — CID 11313054
6-[(E)-7-[tert-butyl(dimethyl)silyl]oxyhept-5-en-1,3-diynyl]pyran-2-one (PubChem CID 11313054) has the molecular formula C18H22O3Si and a molecular weight of 314.46 g/mol. Its IUPAC name is 6-[(E)-7-[tert-butyl(dimethyl)silyl]oxyhept-5-en-1,3-diynyl]pyran-2-one.
| Compound Name | 6-[(E)-7-[tert-butyl(dimethyl)silyl]oxyhept-5-en-1,3-diynyl]pyran-2-one |
|---|---|
| PubChem CID | 11313054 |
| Molecular Formula | C18H22O3Si |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 6-[(E)-7-[tert-butyl(dimethyl)silyl]oxyhept-5-en-1,3-diynyl]pyran-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/C#CC#Cc1cccc(=O)o1 |
| InChI | InChI=1S/C18H22O3Si/c1-18(2,3)22(4,5)20-15-10-8-6-7-9-12-16-13-11-14-17(19)21-16/h8,10-11,13-14H,15H2,1-5H3/b10-8+ |
| InChIKey | ZOKGRPCKEJFZIW-CSKARUKUSA-N |
| XLogP | 3.57 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|