C22H26N2O3 — CID 113130656
N-benzyl-3-(N,3-diacetylanilino)-N-ethylpropanamide (PubChem CID 113130656) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-benzyl-3-(N,3-diacetylanilino)-N-ethylpropanamide.
| Compound Name | N-benzyl-3-(N,3-diacetylanilino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 113130656 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-benzyl-3-(N,3-diacetylanilino)-N-ethylpropanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CCN(C(C)=O)c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-4-23(16-19-9-6-5-7-10-19)22(27)13-14-24(18(3)26)21-12-8-11-20(15-21)17(2)25/h5-12,15H,4,13-14,16H2,1-3H3 |
| InChIKey | ZJSOMGQEUHGWPU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |