C14H12N4O3S — CID 11313105
(E)-2-cyano-3-(2,5-dihydroxyphenyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 11313105) has the molecular formula C14H12N4O3S and a molecular weight of 316.34 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,5-dihydroxyphenyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,5-dihydroxyphenyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 11313105 |
| Molecular Formula | C14H12N4O3S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (E)-2-cyano-3-(2,5-dihydroxyphenyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCc1nnc(NC(=O)/C(C#N)=C/c2cc(O)ccc2O)s1 |
| InChI | InChI=1S/C14H12N4O3S/c1-2-12-17-18-14(22-12)16-13(21)9(7-15)5-8-6-10(19)3-4-11(8)20/h3-6,19-20H,2H2,1H3,(H,16,18,21)/b9-5+ |
| InChIKey | NMSBVAYHKTYQDF-WEVVVXLNSA-N |
| XLogP | 2.06 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|