C15H10F4N4OS — CID 11451523
(E)-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-[2-fluoro-6-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 11451523) has the molecular formula C15H10F4N4OS and a molecular weight of 370.33 g/mol. Its IUPAC name is (E)-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-[2-fluoro-6-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-[2-fluoro-6-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11451523 |
| Molecular Formula | C15H10F4N4OS |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (E)-2-cyano-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-[2-fluoro-6-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCc1nnc(NC(=O)/C(C#N)=C/c2c(F)cccc2C(F)(F)F)s1 |
| InChI | InChI=1S/C15H10F4N4OS/c1-2-12-22-23-14(25-12)21-13(24)8(7-20)6-9-10(15(17,18)19)4-3-5-11(9)16/h3-6H,2H2,1H3,(H,21,23,24)/b8-6+ |
| InChIKey | DSIJUYKQBQICER-SOFGYWHQSA-N |
| XLogP | 3.80 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|