C20H18N2OS — CID 11313629
3-methyl-1,5-diphenyl-5-(1,3-thiazol-2-yl)pyrrolidin-2-one (PubChem CID 11313629) has the molecular formula C20H18N2OS and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-methyl-1,5-diphenyl-5-(1,3-thiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 3-methyl-1,5-diphenyl-5-(1,3-thiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 11313629 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-methyl-1,5-diphenyl-5-(1,3-thiazol-2-yl)pyrrolidin-2-one |
| SMILES | CC1CC(c2ccccc2)(c2nccs2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H18N2OS/c1-15-14-20(19-21-12-13-24-19,16-8-4-2-5-9-16)22(18(15)23)17-10-6-3-7-11-17/h2-13,15H,14H2,1H3 |
| InChIKey | XCEAXKZPYCDDCK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |