C20H19NS — CID 143671126
2-(1-benzhydrylcyclobutyl)-1,3-thiazole (PubChem CID 143671126) has the molecular formula C20H19NS and a molecular weight of 305.45 g/mol. Its IUPAC name is 2-(1-benzhydrylcyclobutyl)-1,3-thiazole.
| Compound Name | 2-(1-benzhydrylcyclobutyl)-1,3-thiazole |
|---|---|
| PubChem CID | 143671126 |
| Molecular Formula | C20H19NS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(1-benzhydrylcyclobutyl)-1,3-thiazole |
| SMILES | c1ccc(C(c2ccccc2)C2(c3nccs3)CCC2)cc1 |
| InChI | InChI=1S/C20H19NS/c1-3-8-16(9-4-1)18(17-10-5-2-6-11-17)20(12-7-13-20)19-21-14-15-22-19/h1-6,8-11,14-15,18H,7,12-13H2 |
| InChIKey | RAXGUEWFOXZIOV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |