C16H19N3OS — CID 71983374
N-phenyl-2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]acetamide (PubChem CID 71983374) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is N-phenyl-2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]acetamide.
| Compound Name | N-phenyl-2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]acetamide |
|---|---|
| PubChem CID | 71983374 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-phenyl-2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]acetamide |
| SMILES | O=C(CNC1(c2nccs2)CCCC1)Nc1ccccc1 |
| InChI | InChI=1S/C16H19N3OS/c20-14(19-13-6-2-1-3-7-13)12-18-16(8-4-5-9-16)15-17-10-11-21-15/h1-3,6-7,10-11,18H,4-5,8-9,12H2,(H,19,20) |
| InChIKey | BQUMPWNWYDPXRB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |