C10H15N3O2S — CID 57235656
2-[(2-methyloxolan-2-yl)amino]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 57235656) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-[(2-methyloxolan-2-yl)amino]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(2-methyloxolan-2-yl)amino]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 57235656 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[(2-methyloxolan-2-yl)amino]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CC1(NCC(=O)Nc2nccs2)CCCO1 |
| InChI | InChI=1S/C10H15N3O2S/c1-10(3-2-5-15-10)12-7-8(14)13-9-11-4-6-16-9/h4,6,12H,2-3,5,7H2,1H3,(H,11,13,14) |
| InChIKey | HNSXVCLTZVKZBL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |