C21H42O3Si — CID 11314714
(5R,9S)-2,9-dimethyl-10-tri(propan-2-yl)silyloxydec-3-yne-2,5-diol (PubChem CID 11314714) has the molecular formula C21H42O3Si and a molecular weight of 370.65 g/mol. Its IUPAC name is (5R,9S)-2,9-dimethyl-10-tri(propan-2-yl)silyloxydec-3-yne-2,5-diol.
| Compound Name | (5R,9S)-2,9-dimethyl-10-tri(propan-2-yl)silyloxydec-3-yne-2,5-diol |
|---|---|
| PubChem CID | 11314714 |
| Molecular Formula | C21H42O3Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (5R,9S)-2,9-dimethyl-10-tri(propan-2-yl)silyloxydec-3-yne-2,5-diol |
| SMILES | CC(C)[Si](OC[C@@H](C)CCC[C@@H](O)C#CC(C)(C)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H42O3Si/c1-16(2)25(17(3)4,18(5)6)24-15-19(7)11-10-12-20(22)13-14-21(8,9)23/h16-20,22-23H,10-12,15H2,1-9H3/t19-,20+/m0/s1 |
| InChIKey | WVUGFYLYHFCNHD-VQTJNVASSA-N |
| XLogP | 5.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|