C23H48O4Si2 — CID 11316745
(1R)-1-[(2S,3S,5Z,8R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propan-1-ol (PubChem CID 11316745) has the molecular formula C23H48O4Si2 and a molecular weight of 444.81 g/mol. Its IUPAC name is (1R)-1-[(2S,3S,5Z,8R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propan-1-ol.
| Compound Name | (1R)-1-[(2S,3S,5Z,8R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propan-1-ol |
|---|---|
| PubChem CID | 11316745 |
| Molecular Formula | C23H48O4Si2 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | (1R)-1-[(2S,3S,5Z,8R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propan-1-ol |
| SMILES | CC[C@@H](O)[C@H]1C/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H48O4Si2/c1-12-18(24)19-15-13-14-16-20(27-29(10,11)23(5,6)7)21(26-19)17-25-28(8,9)22(2,3)4/h13-14,18-21,24H,12,15-17H2,1-11H3/b14-13-/t18-,19-,20+,21+/m1/s1 |
| InChIKey | IDCVWGBMXWOXQZ-KSMBXFNUSA-N |
| XLogP | 6.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|