C23H35NO3S2Si — CID 11317259
(E,3R)-3-hydroxy-5-phenyl-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]pent-4-en-1-one (PubChem CID 11317259) has the molecular formula C23H35NO3S2Si and a molecular weight of 465.76 g/mol. Its IUPAC name is (E,3R)-3-hydroxy-5-phenyl-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]pent-4-en-1-one.
| Compound Name | (E,3R)-3-hydroxy-5-phenyl-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 11317259 |
| Molecular Formula | C23H35NO3S2Si |
| Molecular Weight | 465.76 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | (E,3R)-3-hydroxy-5-phenyl-1-[(4R)-2-sulfanylidene-4-(2-triethylsilyloxypropan-2-yl)-1,3-thiazolidin-3-yl]pent-4-en-1-one |
| SMILES | CC[Si](CC)(CC)OC(C)(C)[C@@H]1CSC(=S)N1C(=O)C[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H35NO3S2Si/c1-6-30(7-2,8-3)27-23(4,5)20-17-29-22(28)24(20)21(26)16-19(25)15-14-18-12-10-9-11-13-18/h9-15,19-20,25H,6-8,16-17H2,1-5H3/b15-14+/t19-,20-/m0/s1 |
| InChIKey | JBVUZQSGIOLRQQ-JKZZLZBNSA-N |
| XLogP | 5.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.76 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|