C24H34O11Si — CID 11318473
[(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-3-[phenyl(trimethylsilyloxy)methoxy]oxan-2-yl]methyl acetate (PubChem CID 11318473) has the molecular formula C24H34O11Si and a molecular weight of 526.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-3-[phenyl(trimethylsilyloxy)methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-3-[phenyl(trimethylsilyloxy)methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11318473 |
| Molecular Formula | C24H34O11Si |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-3-[phenyl(trimethylsilyloxy)methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H34O11Si/c1-14(25)29-13-19-20(34-23(35-36(5,6)7)18-11-9-8-10-12-18)21(30-15(2)26)22(31-16(3)27)24(33-19)32-17(4)28/h8-12,19-24H,13H2,1-7H3/t19-,20-,21+,22-,23?,24+/m1/s1 |
| InChIKey | PFXKQGLRIPXTKF-IHRCBTOASA-N |
| XLogP | 2.64 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|