C34H54O9Si — CID 11319646
[(1R,3R,5S,7S,8S,9R,10R,13S)-7,9,10-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-triethylsilyloxy-13-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate (PubChem CID 11319646) has the molecular formula C34H54O9Si and a molecular weight of 634.88 g/mol. Its IUPAC name is [(1R,3R,5S,7S,8S,9R,10R,13S)-7,9,10-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-triethylsilyloxy-13-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate.
| Compound Name | [(1R,3R,5S,7S,8S,9R,10R,13S)-7,9,10-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-triethylsilyloxy-13-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
|---|---|
| PubChem CID | 11319646 |
| Molecular Formula | C34H54O9Si |
| Molecular Weight | 634.88 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | [(1R,3R,5S,7S,8S,9R,10R,13S)-7,9,10-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-triethylsilyloxy-13-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
| SMILES | C=C1[C@@H](O[Si](CC)(CC)CC)C[C@H](OC(C)=O)[C@]2(C)[C@@H]1C[C@@H]1C[C@H](OC(C)=O)C(C)=C([C@@H](OC(C)=O)[C@@H]2OC(C)=O)C1(C)C |
| InChI | InChI=1S/C34H54O9Si/c1-13-44(14-2,15-3)43-28-18-29(40-22(7)36)34(12)26(19(28)4)16-25-17-27(39-21(6)35)20(5)30(33(25,10)11)31(41-23(8)37)32(34)42-24(9)38/h25-29,31-32H,4,13-18H2,1-3,5-12H3/t25-,26-,27+,28+,29+,31-,32+,34+/m1/s1 |
| InChIKey | KBWQDQADGINSST-FRHVFANGSA-N |
| XLogP | 6.45 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.88 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|