C17H11ClF3N3O3 — CID 113202650
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)propanamide (PubChem CID 113202650) has the molecular formula C17H11ClF3N3O3 and a molecular weight of 397.74 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)propanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)propanamide |
|---|---|
| PubChem CID | 113202650 |
| Molecular Formula | C17H11ClF3N3O3 |
| Molecular Weight | 397.74 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2cccnc2C1=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11ClF3N3O3/c18-12-4-3-9(8-11(12)17(19,20)21)23-13(25)5-7-24-15(26)10-2-1-6-22-14(10)16(24)27/h1-4,6,8H,5,7H2,(H,23,25) |
| InChIKey | AMEZLNUTJOIACL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|