C19H17N3O4 — CID 4604415
N-(3-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide (PubChem CID 4604415) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is N-(3-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide.
| Compound Name | N-(3-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide |
|---|---|
| PubChem CID | 4604415 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-(3-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide |
| SMILES | CC(=O)c1cccc(NC(=O)CCCN2C(=O)c3cccnc3C2=O)c1 |
| InChI | InChI=1S/C19H17N3O4/c1-12(23)13-5-2-6-14(11-13)21-16(24)8-4-10-22-18(25)15-7-3-9-20-17(15)19(22)26/h2-3,5-7,9,11H,4,8,10H2,1H3,(H,21,24) |
| InChIKey | PAAQEUSKMRMGRO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|