C16H19ClN2O3S — CID 113210482
2-(6-chloro-1H-indol-3-yl)-N-(1,1-dioxothiolan-3-yl)-2-methylpropanamide (PubChem CID 113210482) has the molecular formula C16H19ClN2O3S and a molecular weight of 354.86 g/mol. Its IUPAC name is 2-(6-chloro-1H-indol-3-yl)-N-(1,1-dioxothiolan-3-yl)-2-methylpropanamide.
| Compound Name | 2-(6-chloro-1H-indol-3-yl)-N-(1,1-dioxothiolan-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 113210482 |
| Molecular Formula | C16H19ClN2O3S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-(6-chloro-1H-indol-3-yl)-N-(1,1-dioxothiolan-3-yl)-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NC1CCS(=O)(=O)C1)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H19ClN2O3S/c1-16(2,15(20)19-11-5-6-23(21,22)9-11)13-8-18-14-7-10(17)3-4-12(13)14/h3-4,7-8,11,18H,5-6,9H2,1-2H3,(H,19,20) |
| InChIKey | PZKAXKIEBHXQRF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |