C11H16O4 — CID 11321814
methyl (2E)-2-(acetyloxymethyl)-5-methylhexa-2,4-dienoate (PubChem CID 11321814) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is methyl (2E)-2-(acetyloxymethyl)-5-methylhexa-2,4-dienoate.
| Compound Name | methyl (2E)-2-(acetyloxymethyl)-5-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 11321814 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl (2E)-2-(acetyloxymethyl)-5-methylhexa-2,4-dienoate |
| SMILES | COC(=O)/C(=C/C=C(C)C)COC(C)=O |
| InChI | InChI=1S/C11H16O4/c1-8(2)5-6-10(11(13)14-4)7-15-9(3)12/h5-6H,7H2,1-4H3/b10-6+ |
| InChIKey | RAAASUJJRFRASP-UXBLZVDNSA-N |
| XLogP | 1.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|