C10H17F3N2OS — CID 113224668
1-cyclohexyl-3-[2-(trifluoromethylsulfanyl)ethyl]urea (PubChem CID 113224668) has the molecular formula C10H17F3N2OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(trifluoromethylsulfanyl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(trifluoromethylsulfanyl)ethyl]urea |
|---|---|
| PubChem CID | 113224668 |
| Molecular Formula | C10H17F3N2OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-cyclohexyl-3-[2-(trifluoromethylsulfanyl)ethyl]urea |
| SMILES | O=C(NCCSC(F)(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C10H17F3N2OS/c11-10(12,13)17-7-6-14-9(16)15-8-4-2-1-3-5-8/h8H,1-7H2,(H2,14,15,16) |
| InChIKey | BSDVBNUPWXIOIQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|