C18H22N2O4 — CID 113226323
(2S)-2-amino-N-benzyl-3-(3,4-dihydroxyphenyl)-N-(2-hydroxyethyl)propanamide (PubChem CID 113226323) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (2S)-2-amino-N-benzyl-3-(3,4-dihydroxyphenyl)-N-(2-hydroxyethyl)propanamide.
| Compound Name | (2S)-2-amino-N-benzyl-3-(3,4-dihydroxyphenyl)-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 113226323 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (2S)-2-amino-N-benzyl-3-(3,4-dihydroxyphenyl)-N-(2-hydroxyethyl)propanamide |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C18H22N2O4/c19-15(10-14-6-7-16(22)17(23)11-14)18(24)20(8-9-21)12-13-4-2-1-3-5-13/h1-7,11,15,21-23H,8-10,12,19H2/t15-/m0/s1 |
| InChIKey | UAYSPXCSSZUNQQ-HNNXBMFYSA-N |
| XLogP | 0.99 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|