C14H18ClNO2 — CID 11323120
2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetic acid (PubChem CID 11323120) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 11323120 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetic acid |
| SMILES | CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](CC(=O)O)C1 |
| InChI | InChI=1S/C14H18ClNO2/c1-16-7-6-13(11(9-16)8-14(17)18)10-2-4-12(15)5-3-10/h2-5,11,13H,6-9H2,1H3,(H,17,18)/t11-,13+/m0/s1 |
| InChIKey | QEBZNCBTDUQTGK-WCQYABFASA-N |
| XLogP | 2.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |