C13H20F3NO — CID 113236453
N-[(E)-pent-3-enyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 113236453) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[(E)-pent-3-enyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 113236453 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[(E)-pent-3-enyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | C/C=C/CCNC(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H20F3NO/c1-2-3-4-8-17-12(18)10-6-5-7-11(9-10)13(14,15)16/h2-3,10-11H,4-9H2,1H3,(H,17,18)/b3-2+ |
| InChIKey | YXZNMLLEPRQTGQ-NSCUHMNNSA-N |
| XLogP | 3.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|