C10H13F4N3O — CID 113251046
N-(4-cyano-1-methylpiperidin-4-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 113251046) has the molecular formula C10H13F4N3O and a molecular weight of 267.23 g/mol. Its IUPAC name is N-(4-cyano-1-methylpiperidin-4-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(4-cyano-1-methylpiperidin-4-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 113251046 |
| Molecular Formula | C10H13F4N3O |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(4-cyano-1-methylpiperidin-4-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CN1CCC(C#N)(NC(=O)C(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C10H13F4N3O/c1-17-4-2-9(6-15,3-5-17)16-8(18)10(13,14)7(11)12/h7H,2-5H2,1H3,(H,16,18) |
| InChIKey | HBENNXSJTRYCCA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|