C12H19F2N3O — CID 173125803
N-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoropentanamide (PubChem CID 173125803) has the molecular formula C12H19F2N3O and a molecular weight of 259.30 g/mol. Its IUPAC name is N-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoropentanamide.
| Compound Name | N-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoropentanamide |
|---|---|
| PubChem CID | 173125803 |
| Molecular Formula | C12H19F2N3O |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | N-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoropentanamide |
| SMILES | CN1CCC(C#N)(NC(=O)CCC(C)(F)F)CC1 |
| InChI | InChI=1S/C12H19F2N3O/c1-11(13,14)4-3-10(18)16-12(9-15)5-7-17(2)8-6-12/h3-8H2,1-2H3,(H,16,18) |
| InChIKey | PBFDBPVXKBKERE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |