C12H18F2N4O2 — CID 173125815
N'-(4-cyano-1-methylpiperidin-4-yl)-2,2-difluoropentanediamide (PubChem CID 173125815) has the molecular formula C12H18F2N4O2 and a molecular weight of 288.30 g/mol. Its IUPAC name is N'-(4-cyano-1-methylpiperidin-4-yl)-2,2-difluoropentanediamide.
| Compound Name | N'-(4-cyano-1-methylpiperidin-4-yl)-2,2-difluoropentanediamide |
|---|---|
| PubChem CID | 173125815 |
| Molecular Formula | C12H18F2N4O2 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N'-(4-cyano-1-methylpiperidin-4-yl)-2,2-difluoropentanediamide |
| SMILES | CN1CCC(C#N)(NC(=O)CCC(F)(F)C(N)=O)CC1 |
| InChI | InChI=1S/C12H18F2N4O2/c1-18-6-4-11(8-15,5-7-18)17-9(19)2-3-12(13,14)10(16)20/h2-7H2,1H3,(H2,16,20)(H,17,19) |
| InChIKey | NUABWXSQKMXWTO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |