C12H18N2OS2 — CID 113253976
1-(3-ethylpyrrolidin-1-yl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)ethanone (PubChem CID 113253976) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-(3-ethylpyrrolidin-1-yl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(3-ethylpyrrolidin-1-yl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 113253976 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-(3-ethylpyrrolidin-1-yl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)ethanone |
| SMILES | CCC1CCN(C(=O)Cc2sc(=S)[nH]c2C)C1 |
| InChI | InChI=1S/C12H18N2OS2/c1-3-9-4-5-14(7-9)11(15)6-10-8(2)13-12(16)17-10/h9H,3-7H2,1-2H3,(H,13,16) |
| InChIKey | YHVRLTRGGVWGFF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|