C10H14N2OS2 — CID 47128479
2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-1-pyrrolidin-1-ylethanone (PubChem CID 47128479) has the molecular formula C10H14N2OS2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 47128479 |
| Molecular Formula | C10H14N2OS2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)N1CCCC1 |
| InChI | InChI=1S/C10H14N2OS2/c1-7-8(15-10(14)11-7)6-9(13)12-4-2-3-5-12/h2-6H2,1H3,(H,11,14) |
| InChIKey | DKYGVGRTRBEVSB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|