C25H28O2 — CID 11325875
(Z)-2-[(4-phenylcyclohexylidene)methyl]-3-[(E)-2-phenylethenyl]but-2-ene-1,4-diol (PubChem CID 11325875) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (Z)-2-[(4-phenylcyclohexylidene)methyl]-3-[(E)-2-phenylethenyl]but-2-ene-1,4-diol.
| Compound Name | (Z)-2-[(4-phenylcyclohexylidene)methyl]-3-[(E)-2-phenylethenyl]but-2-ene-1,4-diol |
|---|---|
| PubChem CID | 11325875 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (Z)-2-[(4-phenylcyclohexylidene)methyl]-3-[(E)-2-phenylethenyl]but-2-ene-1,4-diol |
| SMILES | OC/C(C=C1CCC(c2ccccc2)CC1)=C(/C=C/c1ccccc1)CO |
| InChI | InChI=1S/C25H28O2/c26-18-24(16-11-20-7-3-1-4-8-20)25(19-27)17-21-12-14-23(15-13-21)22-9-5-2-6-10-22/h1-11,16-17,23,26-27H,12-15,18-19H2/b16-11+,21-17-,25-24- |
| InChIKey | JJTNNYZKGZVKNA-CXJPHSOUSA-N |
| XLogP | 5.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|