C18H17N — CID 11334122
2-phenyl-5-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyrrole (PubChem CID 11334122) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-phenyl-5-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-phenyl-5-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 11334122 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-phenyl-5-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyrrole |
| SMILES | C(=C/c1ccccc1)\C1=NC(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H17N/c1-3-7-15(8-4-1)11-12-17-13-14-18(19-17)16-9-5-2-6-10-16/h1-12,18H,13-14H2/b12-11+ |
| InChIKey | FQMCTRQPRMWGRE-VAWYXSNFSA-N |
| XLogP | 4.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |