C15H24N2O — CID 113260561
5-(3,3-dimethylbutylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 113260561) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 5-(3,3-dimethylbutylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 5-(3,3-dimethylbutylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 113260561 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 5-(3,3-dimethylbutylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | CC(C)(C)CCNC1CCCc2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C15H24N2O/c1-15(2,3)9-10-16-12-5-4-6-13-11(12)7-8-14(18)17-13/h7-8,12,16H,4-6,9-10H2,1-3H3,(H,17,18) |
| InChIKey | PDHGZTUCAVAZOS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |