C14H22N2O2 — CID 113429600
5-(2-propan-2-yloxyethylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 113429600) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-(2-propan-2-yloxyethylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 5-(2-propan-2-yloxyethylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 113429600 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 5-(2-propan-2-yloxyethylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | CC(C)OCCNC1CCCc2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C14H22N2O2/c1-10(2)18-9-8-15-12-4-3-5-13-11(12)6-7-14(17)16-13/h6-7,10,12,15H,3-5,8-9H2,1-2H3,(H,16,17) |
| InChIKey | JTAPUMUAMRQNLH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|