C15H21NOS — CID 113262116
[2-(3,4-dihydro-2H-thiochromen-4-ylamino)cyclopentyl]methanol (PubChem CID 113262116) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-thiochromen-4-ylamino)cyclopentyl]methanol.
| Compound Name | [2-(3,4-dihydro-2H-thiochromen-4-ylamino)cyclopentyl]methanol |
|---|---|
| PubChem CID | 113262116 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [2-(3,4-dihydro-2H-thiochromen-4-ylamino)cyclopentyl]methanol |
| SMILES | OCC1CCCC1NC1CCSc2ccccc21 |
| InChI | InChI=1S/C15H21NOS/c17-10-11-4-3-6-13(11)16-14-8-9-18-15-7-2-1-5-12(14)15/h1-2,5,7,11,13-14,16-17H,3-4,6,8-10H2 |
| InChIKey | KPQVKDYAVRSKFE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |