C16H21NOS — CID 91660355
[(1R,4S)-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-ylamino)cyclopent-2-en-1-yl]methanol (PubChem CID 91660355) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is [(1R,4S)-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-ylamino)cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-ylamino)cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 91660355 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | [(1R,4S)-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-ylamino)cyclopent-2-en-1-yl]methanol |
| SMILES | OC[C@H]1C=C[C@@H](NC2CCCSc3ccccc32)C1 |
| InChI | InChI=1S/C16H21NOS/c18-11-12-7-8-13(10-12)17-15-5-3-9-19-16-6-2-1-4-14(15)16/h1-2,4,6-8,12-13,15,17-18H,3,5,9-11H2/t12-,13+,15?/m0/s1 |
| InChIKey | VXUFWFLSMHCTLQ-IKCIUXDWSA-N |
| XLogP | 3.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|