C15H18ClNOS — CID 99821461
[(1R,4S)-4-[[(4R)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]amino]cyclopent-2-en-1-yl]methanol (PubChem CID 99821461) has the molecular formula C15H18ClNOS and a molecular weight of 295.83 g/mol. Its IUPAC name is [(1R,4S)-4-[[(4R)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[[(4R)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 99821461 |
| Molecular Formula | C15H18ClNOS |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | [(1R,4S)-4-[[(4R)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]amino]cyclopent-2-en-1-yl]methanol |
| SMILES | OC[C@H]1C=C[C@@H](N[C@@H]2CCSc3ccc(Cl)cc32)C1 |
| InChI | InChI=1S/C15H18ClNOS/c16-11-2-4-15-13(8-11)14(5-6-19-15)17-12-3-1-10(7-12)9-18/h1-4,8,10,12,14,17-18H,5-7,9H2/t10-,12+,14+/m0/s1 |
| InChIKey | PRXUGYOXYCNHSL-ZKYQVNSYSA-N |
| XLogP | 3.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|