About N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine
N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine (PubChem CID 79730659) has the molecular formula C13H17ClN2S
and a molecular weight of 268.81 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine |
| PubChem CID | 79730659 |
| Molecular Formula | C13H17ClN2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine |
| SMILES | Clc1ccc2c(c1)C(NC1CCNC1)CCS2 |
| InChI | InChI=1S/C13H17ClN2S/c14-9-1-2-13-11(7-9)12(4-6-17-13)16-10-3-5-15-8-10/h1-2,7,10,12,15-16H,3-6,8H2 |
| InChIKey | BNXYFCWRBDQJAR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine?
The IUPAC name of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine (CID 79730659) is N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine.
What is the SMILES notation for N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine?
The canonical SMILES for N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine is Clc1ccc2c(c1)C(NC1CCNC1)CCS2.
What is the InChIKey of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine?
The InChIKey is BNXYFCWRBDQJAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2S/c14-9-1-2-13-11(7-9)12(4-6-17-13)16-10-3-5-15-8-10/h1-2,7,10,12,15-16H,3-6,8H2.
What are the key properties of N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine?
N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine has a molecular weight of 268.81 g/mol, XLogP of 2.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyrrolidin-3-amine is sourced from PubChem (CID 79730659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).