About 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide
9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120984131) has the molecular formula C19H25ClN2OS
and a molecular weight of 364.94 g/mol. Its IUPAC name is 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide.
Molecular Properties
| Compound Name | 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide |
| PubChem CID | 120984131 |
| Molecular Formula | C19H25ClN2OS |
| Molecular Weight | 364.94 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | NC1C2CCCC1CC(C(=O)NC1CCSc3ccc(Cl)cc31)C2 |
| InChI | InChI=1S/C19H25ClN2OS/c20-14-4-5-17-15(10-14)16(6-7-24-17)22-19(23)13-8-11-2-1-3-12(9-13)18(11)21/h4-5,10-13,16,18H,1-3,6-9,21H2,(H,22,23) |
| InChIKey | DYXDESQITLJPPM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.94 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide?
The IUPAC name of 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide (CID 120984131) is 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide.
What is the SMILES notation for 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide?
The canonical SMILES for 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide is NC1C2CCCC1CC(C(=O)NC1CCSc3ccc(Cl)cc31)C2.
What is the InChIKey of 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide?
The InChIKey is DYXDESQITLJPPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25ClN2OS/c20-14-4-5-17-15(10-14)16(6-7-24-17)22-19(23)13-8-11-2-1-3-12(9-13)18(11)21/h4-5,10-13,16,18H,1-3,6-9,21H2,(H,22,23).
What are the key properties of 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide?
9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide has a molecular weight of 364.94 g/mol, XLogP of 4.15, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)bicyclo[3.3.1]nonane-3-carboxamide is sourced from PubChem (CID 120984131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).