C14H21NOS — CID 71915910
4-(2,3,4,5-tetrahydro-1-benzothiepin-5-ylamino)butan-2-ol (PubChem CID 71915910) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 4-(2,3,4,5-tetrahydro-1-benzothiepin-5-ylamino)butan-2-ol.
| Compound Name | 4-(2,3,4,5-tetrahydro-1-benzothiepin-5-ylamino)butan-2-ol |
|---|---|
| PubChem CID | 71915910 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-(2,3,4,5-tetrahydro-1-benzothiepin-5-ylamino)butan-2-ol |
| SMILES | CC(O)CCNC1CCCSc2ccccc21 |
| InChI | InChI=1S/C14H21NOS/c1-11(16)8-9-15-13-6-4-10-17-14-7-3-2-5-12(13)14/h2-3,5,7,11,13,15-16H,4,6,8-10H2,1H3 |
| InChIKey | QNSWUJNGKGCFRV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |