C18H21NOS — CID 166197136
N-(2-phenoxypropyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 166197136) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is N-(2-phenoxypropyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-(2-phenoxypropyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 166197136 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(2-phenoxypropyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CC(CNC1CCSc2ccccc21)Oc1ccccc1 |
| InChI | InChI=1S/C18H21NOS/c1-14(20-15-7-3-2-4-8-15)13-19-17-11-12-21-18-10-6-5-9-16(17)18/h2-10,14,17,19H,11-13H2,1H3 |
| InChIKey | FLCUFFQPKZUFTF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |