C20H40O4Si2 — CID 11327064
(4S,5R,9R)-4,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[4.4]nonan-2-one (PubChem CID 11327064) has the molecular formula C20H40O4Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is (4S,5R,9R)-4,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[4.4]nonan-2-one.
| Compound Name | (4S,5R,9R)-4,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 11327064 |
| Molecular Formula | C20H40O4Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (4S,5R,9R)-4,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[4.4]nonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)O[C@@]12CCC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si2/c1-18(2,3)25(7,8)23-15-12-11-13-20(15)16(14-17(21)22-20)24-26(9,10)19(4,5)6/h15-16H,11-14H2,1-10H3/t15-,16+,20-/m1/s1 |
| InChIKey | FFEBRYWSEXKETR-GQIGUUNPSA-N |
| XLogP | 5.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|