C18H18N2O4Se — CID 11327190
3,5-bis(3,4-dimethoxyphenyl)-1,2,4-selenadiazole (PubChem CID 11327190) has the molecular formula C18H18N2O4Se and a molecular weight of 405.31 g/mol. Its IUPAC name is 3,5-bis(3,4-dimethoxyphenyl)-1,2,4-selenadiazole.
| Compound Name | 3,5-bis(3,4-dimethoxyphenyl)-1,2,4-selenadiazole |
|---|---|
| PubChem CID | 11327190 |
| Molecular Formula | C18H18N2O4Se |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 3,5-bis(3,4-dimethoxyphenyl)-1,2,4-selenadiazole |
| SMILES | COc1ccc(-c2n[se]c(-c3ccc(OC)c(OC)c3)n2)cc1OC |
| InChI | InChI=1S/C18H18N2O4Se/c1-21-13-7-5-11(9-15(13)23-3)17-19-18(25-20-17)12-6-8-14(22-2)16(10-12)24-4/h5-10H,1-4H3 |
| InChIKey | RBMZXPKLGCVGIC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|