C14H17ClINO — CID 113273857
N-[[2-(chloromethyl)cyclopentyl]methyl]-3-iodobenzamide (PubChem CID 113273857) has the molecular formula C14H17ClINO and a molecular weight of 377.65 g/mol. Its IUPAC name is N-[[2-(chloromethyl)cyclopentyl]methyl]-3-iodobenzamide.
| Compound Name | N-[[2-(chloromethyl)cyclopentyl]methyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 113273857 |
| Molecular Formula | C14H17ClINO |
| Molecular Weight | 377.65 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | N-[[2-(chloromethyl)cyclopentyl]methyl]-3-iodobenzamide |
| SMILES | O=C(NCC1CCCC1CCl)c1cccc(I)c1 |
| InChI | InChI=1S/C14H17ClINO/c15-8-11-4-1-5-12(11)9-17-14(18)10-3-2-6-13(16)7-10/h2-3,6-7,11-12H,1,4-5,8-9H2,(H,17,18) |
| InChIKey | YLJVZZSOHYATME-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|