C14H26N2O2 — CID 113283325
1-(2-amino-2-ethylbutyl)-3,3-diethylpyrrolidine-2,5-dione (PubChem CID 113283325) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-(2-amino-2-ethylbutyl)-3,3-diethylpyrrolidine-2,5-dione.
| Compound Name | 1-(2-amino-2-ethylbutyl)-3,3-diethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 113283325 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-(2-amino-2-ethylbutyl)-3,3-diethylpyrrolidine-2,5-dione |
| SMILES | CCC(N)(CC)CN1C(=O)CC(CC)(CC)C1=O |
| InChI | InChI=1S/C14H26N2O2/c1-5-13(6-2)9-11(17)16(12(13)18)10-14(15,7-3)8-4/h5-10,15H2,1-4H3 |
| InChIKey | TXLFNUOGIQNXLQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|