C13H23NO3 — CID 65117523
3,3-diethyl-1-(2-hydroxy-2-methylbutyl)pyrrolidine-2,5-dione (PubChem CID 65117523) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 3,3-diethyl-1-(2-hydroxy-2-methylbutyl)pyrrolidine-2,5-dione.
| Compound Name | 3,3-diethyl-1-(2-hydroxy-2-methylbutyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 65117523 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 3,3-diethyl-1-(2-hydroxy-2-methylbutyl)pyrrolidine-2,5-dione |
| SMILES | CCC(C)(O)CN1C(=O)CC(CC)(CC)C1=O |
| InChI | InChI=1S/C13H23NO3/c1-5-12(4,17)9-14-10(15)8-13(6-2,7-3)11(14)16/h17H,5-9H2,1-4H3 |
| InChIKey | JDDSWPKPULOUBF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|